For research use only. Not for therapeutic Use.
Urolithin D(CAT: R014672) is a compound that belongs to the class of molecules known as ellagitannins. Urolithin D is a metabolite of ellagitannins, which are found in certain fruits such as pomegranates, strawberries, and raspberries. Urolithin D has been studied for its potential health benefits, including anti-inflammatory and anti-cancer properties. Additionally, it has been investigated for its effects on mitochondrial function and for its potential to improve muscle health and athletic performance.
CAS Number | 131086-98-1 |
Synonyms | 3,4,8,9-Tetrahydroxyurolithin; 3,4,8,9-Tetrahydroxy-6H-dibenzo[b,d]pyran-6-one? |
Molecular Formula | C13H8O6 |
Purity | ≥95% |
Target | Ephrin Receptor |
Storage | Desiccate at RT |
IUPAC Name | 3,4,8,9-tetrahydroxybenzo[c]chromen-6-one |
InChI | InChI=1S/C13H8O6/c14-8-2-1-5-6-3-9(15)10(16)4-7(6)13(18)19-12(5)11(8)17/h1-4,14-17H |
InChIKey | NEZDQSKPNPRYAW-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C2=C1C3=CC(=C(C=C3C(=O)O2)O)O)O)O |