For research use only. Not for therapeutic Use.
Urolithin M6 (Cat No.:C000899) is a bioactive compound belonging to the urolithin family, derived from ellagic acid metabolism. It is formed by the gut microbiota when ellagitannins, present in certain fruits and nuts, are consumed. Urolithin M6 has gained attention for its potential health benefits, particularly its anti-inflammatory and antioxidant properties. Research suggests that it may play a role in promoting mitochondrial function, cellular health, and longevity.
| Catalog Number | C000899 |
| CAS Number | 1006683-97-1 |
| Synonyms | 3,8,9,10-Tetrahydroxy-6H-dibenzo[b,d]pyran-6-one; 3,8,9,10-Tetrahydroxyurolithin; |
| Molecular Formula | C₁₃H₈O₆ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| Appearance | Light Beige to Dark Brown Solid |
| Storage | -20°C, Inert atmosphere |
| IUPAC Name | 3,8,9,10-tetrahydroxybenzo[c]chromen-6-one |
| InChI | InChI=1S/C13H8O6/c14-5-1-2-6-9(3-5)19-13(18)7-4-8(15)11(16)12(17)10(6)7/h1-4,14-17H |
| InChIKey | LGXFTZDSEIQMMP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC(=O)C3=CC(=C(C(=C23)O)O)O |
| Reference | Garcia-Villalba, R., et al.: J. Agr. Food Chem., 61, 8797 (2013); |
