For research use only. Not for therapeutic Use.
Usnic Acid(Cat No.:M070138)is a naturally occurring compound found in various lichen species, known for its antimicrobial, antiviral, and anti-inflammatory properties. It has a long history of use in traditional medicine and is studied for potential therapeutic applications, including wound healing, respiratory infections, and as an ingredient in topical preparations. Usnic acid also serves as a natural preservative in cosmetics and personal care products. Despite its benefits, caution is advised in its use, as high doses or prolonged exposure can lead to toxicity, particularly in the liver, requiring careful formulation.
CAS Number | 125-46-2 |
Synonyms | NSC 8517 |
Molecular Formula | C18H16O7 |
Purity | ≥95% |
Target | Bacterial |
Storage | 2-8°C |
IUPAC Name | 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
InChI | InChI=1S/C18H16O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,11,22-23H,1-4H3 |
InChIKey | CUCUKLJLRRAKFN-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C2C(=C1O)C3(C(=CC(=O)C(C3=O)C(=O)C)O2)C)C(=O)C)O |
Reference | Usnic acid. Ingolfsdottir K. Phytochemistry 2002, 61, 729.</span></p> |