For research use only. Not for therapeutic Use.
Usnic acid(Cat No.:R025046)is a naturally occurring lichen-derived compound known for its antimicrobial, anti-inflammatory, and antioxidant properties. It has been widely studied for its potential therapeutic applications, including wound healing, antifungal treatments, and as a natural preservative. Usnic acid’s antimicrobial activity is particularly effective against bacteria, including antibiotic-resistant strains, making it a promising candidate for addressing infections. Additionally, it has shown potential in cancer research due to its ability to induce apoptosis in cancer cells.
CAS Number | 7562-61-0 |
Synonyms | (R)-Usnic Acid; (+)-Usnic Acid; (+)-Usninic Acid; (R)-Usnic Acid; NSC 685596; d-Usnic Acid; d-Usninic Acid;? |
Molecular Formula | C18H16O7 |
Purity | ≥95% |
Target | Anti-infection |
Storage | 3 years -20C powder |
IUPAC Name | (9bS)-2,6-diacetyl-3,7,9-trihydroxy-8,9b-dimethyldibenzofuran-1-one |
InChI | InChI=1S/C18H16O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,21-23H,1-4H3/t18-/m1/s1 |
InChIKey | WEYVVCKOOFYHRW-GOSISDBHSA-N |
SMILES | CC1=C(C(=C2C(=C1O)[C@]3(C(=CC(=C(C3=O)C(=O)C)O)O2)C)C(=O)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |