For research use only. Not for therapeutic Use.
USP15-IN-1（Cat No.:I042909）is a selective inhibitor targeting the deubiquitinase enzyme USP15 (Ubiquitin-Specific Protease 15). USP15 plays a crucial role in regulating protein degradation and cellular signaling by removing ubiquitin chains from substrates, influencing processes like immune response, cell cycle regulation, and DNA repair. Inhibition of USP15 using USP15-IN-1 has shown promise in modulating these pathways, with potential applications in cancer research, autoimmune diseases, and neurodegenerative conditions. By disrupting USP15 activity, USP15-IN-1 provides valuable insights into therapeutic strategies aimed at regulating protein homeostasis and cellular function in disease.
| CAS Number | 2260826-16-0 |
| Synonyms | N-(2-hydroxyethyl)-2-(2-phenylacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
| Molecular Formula | C22H23N3O3 |
| Purity | ≥95% |
| IUPAC Name | N-(2-hydroxyethyl)-2-(2-phenylacetyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
| InChI | InChI=1S/C22H23N3O3/c26-11-9-23-22(28)16-6-7-19-18(13-16)17-8-10-25(14-20(17)24-19)21(27)12-15-4-2-1-3-5-15/h1-7,13,24,26H,8-12,14H2,(H,23,28) |
| InChIKey | GVWIQMYLHREBIR-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C3=C(N2)C=CC(=C3)C(=O)NCCO)C(=O)CC4=CC=CC=C4 |
