For research use only. Not for therapeutic Use.
USP7-IN-10 hydrochloride(CAT: I040828), also known as compound 1, is a potent inhibitor of ubiquitin-specific protease 7 (USP7), exhibiting an IC₅₀ value of 13.39 nM. USP7 is a deubiquitinating enzyme involved in the regulation of various proteins, including p53, MDM2, and PTEN, which play critical roles in cell cycle control, DNA repair, and tumor suppression. By inhibiting USP7, USP7-IN-10 hydrochloride can modulate the stability and activity of these target proteins, making it a valuable tool for research into cancer biology and the development of novel therapeutic strategies targeting the ubiquitin-proteasome system.
| Synonyms | 3-[[3-(5-chloro-3-methyl-2-piperidin-4-yloxyphenyl)-2-methylthieno[3,2-c]pyrazol-5-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;hydrochloride |
| Molecular Formula | C26H30Cl2N4O3S |
| Purity | ≥95% |
| IUPAC Name | 3-[[3-(5-chloro-3-methyl-2-piperidin-4-yloxyphenyl)-2-methylthieno[3,2-c]pyrazol-5-yl]methyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione;hydrochloride |
| InChI | InChI=1S/C26H29ClN4O3S.ClH/c1-13-9-14(27)10-17(22(13)34-15-5-7-28-8-6-15)21-23-18(29-30(21)4)11-16(35-23)12-31-24(32)19-20(25(31)33)26(19,2)3;/h9-11,15,19-20,28H,5-8,12H2,1-4H3;1H |
| InChIKey | DLTAAJRLGMHLRJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC2CCNCC2)C3=C4C(=NN3C)C=C(S4)CN5C(=O)C6C(C5=O)C6(C)C)Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
