For research use only. Not for therapeutic Use.
V-0219 hydrochloride（Cat No.:I041423）is an experimental small-molecule compound primarily being investigated for its potential in cancer treatment. It acts by targeting specific cellular pathways involved in tumor growth and survival, particularly focusing on inhibiting key enzymes and kinases that regulate cell proliferation. Preclinical studies have shown that V-0219 hydrochloride may help to reduce tumor size and inhibit metastasis. Ongoing research is evaluating its safety, pharmacokinetics, and therapeutic efficacy in various cancer models. It holds promise as a novel therapeutic agent in the fight against cancer, though further clinical trials are needed.
| CAS Number | 2922283-73-4 |
| Synonyms | 4-[[1-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperidin-3-yl]methyl]morpholine;hydrochloride |
| Molecular Formula | C20H26ClF3N4O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[[1-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperidin-3-yl]methyl]morpholine;hydrochloride |
| InChI | InChI=1S/C20H25F3N4O2.ClH/c21-20(22,23)17-5-3-16(4-6-17)19-24-18(29-25-19)14-27-7-1-2-15(13-27)12-26-8-10-28-11-9-26;/h3-6,15H,1-2,7-14H2;1H |
| InChIKey | PTRIYHLSBQMDQM-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=NC(=NO2)C3=CC=C(C=C3)C(F)(F)F)CN4CCOCC4.Cl |
