For research use only. Not for therapeutic Use.
V-0219（Cat No.:I043718）is a selective small molecule inhibitor targeting the protein HDAC6 (histone deacetylase 6), an enzyme involved in regulating cellular processes such as protein degradation, autophagy, and inflammation. By inhibiting HDAC6, V-0219 disrupts the deacetylation of tubulin and other substrates, leading to altered cellular functions, including enhanced protein degradation and autophagic flux. Preclinical studies suggest that V-0219 has potential therapeutic applications in cancer, neurodegenerative diseases, and inflammatory conditions. Its ability to modulate cellular stress responses and autophagy pathways makes it a promising candidate for disease treatment.
| CAS Number | 878453-71-5 |
| Synonyms | 4-[[1-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperidin-3-yl]methyl]morpholine |
| Molecular Formula | C20H25F3N4O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[[1-[[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl]piperidin-3-yl]methyl]morpholine |
| InChI | InChI=1S/C20H25F3N4O2/c21-20(22,23)17-5-3-16(4-6-17)19-24-18(29-25-19)14-27-7-1-2-15(13-27)12-26-8-10-28-11-9-26/h3-6,15H,1-2,7-14H2 |
| InChIKey | VFQGZIAZHIRPPQ-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=NC(=NO2)C3=CC=C(C=C3)C(F)(F)F)CN4CCOCC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
