Vabicaserin HCl (Cat No.:I009975) is a selective agonist of the 5-HT2C (5-hydroxytryptamine 2C) receptor, a subtype of serotonin receptors. It has shown potential for the treatment of schizophrenia, a complex psychiatric disorder characterized by altered perception, cognition, and behavior. By activating the 5-HT2C receptors, vabicaserin HCl modulates the neurotransmitter serotonin in the brain, which is believed to play a role in regulating mood and cognition. The specific mechanism of action of vabicaserin HCl in treating schizophrenia is not fully understood, but its selective activity on the 5-HT2C receptors suggests it may have an impact on the underlying neurobiology of the disorder.
| Catalog Number | I009975 |
| CAS Number | 887258-94-8 |
| Synonyms | SCA-136; PF-05208769; PF-5208769; SCA136; PF05208769; PF5208769; SCA 136; PF 05208769; PF 5208769;(9aR,12aS)-4,5,6,7,9,9a,10,11,12,12a-decahydrocyclopenta[c][1,4]diazepino[6,7,1-ij]quinoline hydrochloride |
| Molecular Formula | C15H21ClN2 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | (12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-triene;hydrochloride |
| InChI | InChI=1S/C15H20N2.ClH/c1-3-11-9-16-7-8-17-10-12-4-2-5-13(12)14(6-1)15(11)17;/h1,3,6,12-13,16H,2,4-5,7-10H2;1H/t12-,13-;/m0./s1 |
| InChIKey | PYPPENBDXAWXJC-QNTKWALQSA-N |
| SMILES | C1C[C@H]2CN3CCNCC4=C3C(=CC=C4)[C@H]2C1.Cl |
| Reference | <br /> |
