For research use only. Not for therapeutic Use.
Vactosertib Hydrochloride(Cat No.:I020416)is a small molecule inhibitor that targets the Transforming Growth Factor-Beta (TGF-β) receptor type 1 kinase, which plays a key role in various cellular processes such as cell growth, differentiation, and fibrosis. It is being investigated for its potential therapeutic applications in cancer and fibrotic diseases. By inhibiting the TGF-β signaling pathway, Vactosertib Hydrochloride may help reduce tumor progression and fibrosis, offering a promising treatment strategy for conditions like non-small cell lung cancer, liver fibrosis, and other diseases driven by excessive TGF-β signaling. Clinical studies are ongoing to assess its efficacy and safety.
CAS Number | 1352610-25-3 |
Molecular Formula | C₂₂H₁₉ClFN₇ |
Purity | ≥95% |
Target | TGF-β Receptor |
IUPAC Name | 2-fluoro-N-[[5-(6-methylpyridin-2-yl)-4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1H-imidazol-2-yl]methyl]aniline;hydrochloride |
InChI | InChI=1S/C22H18FN7.ClH/c1-14-5-4-8-18(27-14)22-21(15-9-10-20-25-13-26-30(20)12-15)28-19(29-22)11-24-17-7-3-2-6-16(17)23;/h2-10,12-13,24H,11H2,1H3,(H,28,29);1H |
InChIKey | UDRJLVATGDHMJM-UHFFFAOYSA-N |
SMILES | CC1=NC(=CC=C1)C2=C(N=C(N2)CNC3=CC=CC=C3F)C4=CN5C(=NC=N5)C=C4.Cl |