For research use only. Not for therapeutic Use.
Val-cit-PAB-OH (Cat No.: I002027) is a degradable antibody-drug conjugate (ADC) linker with diverse applications. It serves as a crucial reagent in the preparation of cell-penetrating peptide GRP78 ligands for targeted prodrug therapy in tumor cells. Additionally, it plays a pivotal role in the development of ligands and antibodies derived from monomethyl valine, contributing to innovative cancer treatment approaches. Researchers interested in utilizing Val-cit-PAB-OH for these purposes or seeking further information can contact us for support.
CAS Number | 159857-79-1 |
Molecular Formula | C18H29N5O4 |
Purity | ≥95% |
Target | ADC Linker |
Solubility | DMSO: ≥ 59 mg/mL |
Storage | 2-8°C(protect from light) |
IUPAC Name | (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-5-(carbamoylamino)-N-[4-(hydroxymethyl)phenyl]pentanamide |
InChI | InChI=1S/C18H29N5O4/c1-11(2)15(19)17(26)23-14(4-3-9-21-18(20)27)16(25)22-13-7-5-12(10-24)6-8-13/h5-8,11,14-15,24H,3-4,9-10,19H2,1-2H3,(H,22,25)(H,23,26)(H3,20,21,27)/t14-,15-/m0/s1 |
InChIKey | VEGGTWZUZGZKHY-GJZGRUSLSA-N |
SMILES | CC(C)C(C(=O)NC(CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)CO)N |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |