For research use only. Not for therapeutic Use.
Valeric acid, also known as pentanoic acid, is a straight-chain saturated fatty acid with the chemical formula C5H10O2. It is characterized by a pungent odor and is found naturally in plant oils. Valeric acid is used in the production of flavors, fragrances, and pharmaceuticals. It also serves as a precursor in the synthesis of various esters and other chemicals.
| Catalog Number | R029242 |
| CAS Number | 109-52-4 |
| Synonyms | 1-Butanecarboxylic Acid; NSC 406833; Propylacetic Acid; n-Pentanoic Acid; n-Valeric Acid |
| Molecular Formula | C5H10O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | pentanoic acid |
| InChI | InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7) |
| InChIKey | NQPDZGIKBAWPEJ-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)O |
