For research use only. Not for therapeutic Use.
Valeric Acid Sodium Salt is the sodium salt form of valeric acid, a five-carbon straight-chain fatty acid known for its role in various biological processes. This compound is used in biochemical research and as a flavoring agent in food products. Its sodium salt form enhances solubility in water, making it suitable for various applications, including pharmaceuticals and industrial processes. Valeric Acid Sodium Salt also exhibits antimicrobial properties, contributing to its potential use in preservative formulations and enhancing product stability in formulations.
Catalog Number | R055563 |
CAS Number | 6106-41-8 |
Synonyms | Pentanoic Acid Sodium Salt; Sodium n-Valerate; Sodium Pentanoate; Sodium Valerate |
Molecular Formula | C5H9NaO2 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | sodium;pentanoate |
InChI | InChI=1S/C5H10O2.Na/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1 |
InChIKey | LHYPLJGBYPAQAK-UHFFFAOYSA-M |
SMILES | CCCCC(=O)[O-].[Na+] |