For research use only. Not for therapeutic Use.
Valeryl salicylate(Cat No.:I011557)is an ester of salicylic acid and valeric acid, known for its anti-inflammatory and analgesic properties. It is commonly used in topical applications, such as in creams and ointments, for pain relief and to reduce inflammation in conditions like arthritis and muscle soreness. Valeryl salicylate works by inhibiting cyclooxygenase (COX) enzymes, which play a role in the production of pro-inflammatory compounds. It has been investigated for its potential to provide effective relief with fewer gastrointestinal side effects compared to traditional salicylates, making it a valuable compound in pain management therapies.
CAS Number | 64206-54-8 |
Synonyms | 2-pentanoyloxybenzoic acid |
Molecular Formula | C12H14O4 |
Purity | ≥95% |
IUPAC Name | 2-pentanoyloxybenzoic acid |
InChI | InChI=1S/C12H14O4/c1-2-3-8-11(13)16-10-7-5-4-6-9(10)12(14)15/h4-7H,2-3,8H2,1H3,(H,14,15) |
InChIKey | WJHZBTMHUNVIKC-UHFFFAOYSA-N |
SMILES | CCCCC(=O)OC1=CC=CC=C1C(=O)O |