For research use only. Not for therapeutic Use.
Validamycin A(Cat No.:R001150), is a naturally occurring antibiotic and agricultural fungicide derived from Streptomyces hygroscopicus var. limoneus. This compound inhibits the growth of various fungi, making it valuable in protecting crops from fungal diseases. Validamycin A disrupts fungal cell wall formation, ultimately suppressing their ability to infect plants. It is particularly effective against pathogenic fungi like Rhizoctonia and Pyricularia, which cause crop damage. Its eco-friendly profile and low mammalian toxicity have contributed to its use in sustainable agriculture.
CAS Number | 37248-47-8 |
Synonyms | Validacin |
Molecular Formula | C20H35NO13 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | 0-6°C |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[(1R,2R,3S,4S,6R)-2,3-dihydroxy-6-(hydroxymethyl)-4-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]cyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
InChI | InChI=1S/C20H35NO13/c22-3-6-1-8(12(26)15(29)11(6)25)21-9-2-7(4-23)19(17(31)13(9)27)34-20-18(32)16(30)14(28)10(5-24)33-20/h1,7-32H,2-5H2/t7-,8+,9+,10-,11-,12+,13+,14-,15+,16+,17-,18-,19-,20+/m1/s1 |
InChIKey | JARYYMUOCXVXNK-CSLFJTBJSA-N |
SMILES | C1[C@@H]([C@H]([C@@H]([C@H]([C@H]1N[C@H]2C=C([C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)CO |
Reference | Copping LG [ed.], 2004. The Manual of Biocontrol Agents. Alton, UK: BCPC.</span></p> |