For research use only. Not for therapeutic Use.
Valnoctamide-d5(Cat No.:R007166) is a deuterated version of valnoctamide, where five hydrogen atoms are replaced with deuterium. This isotopic labeling significantly enhances the molecule’s stability, making it particularly useful for pharmacokinetic and metabolic studies. Valnoctamide is a derivative of valproic acid, used primarily as an anticonvulsant and mood-stabilizing drug. The deuterated form, Valnoctamide-d5, allows researchers to more accurately trace and analyze the drug’s behavior in the body, enhancing understanding of its absorption, distribution, metabolism, and excretion.
CAS Number | 1190015-82-7 |
Synonyms | 2-Ethyl-d5-3-methylpentan-amide; 2-Ethyl-d5-3-methylvaleramide; Valmethamide-d5; McN-X-181-d5; Axiquel-d5; Nirvanil-d5; |
Molecular Formula | C8H17NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-methyl-2-(1,1,2,2,2-pentadeuterioethyl)pentanamide |
InChI | InChI=1S/C8H17NO/c1-4-6(3)7(5-2)8(9)10/h6-7H,4-5H2,1-3H3,(H2,9,10)/i2D3,5D2 |
InChIKey | QRCJOCOSPZMDJY-ZTIZGVCASA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C(C(C)CC)C(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |