For research use only. Not for therapeutic Use.
Valproic acid (Cat No.:I005748) is not only an antiepileptic drug but also a histone deacetylase (HDAC) inhibitor. HDACs are enzymes that remove acetyl groups from histone proteins, leading to chromatin compaction and gene silencing. By inhibiting HDACs, valproic acid promotes histone acetylation, which results in a more relaxed chromatin structure and increased gene transcription. This epigenetic modulation can have various effects on cellular processes, including the regulation of gene expression involved in cell growth, differentiation, and apoptosis. Valproic acid’s HDAC inhibitory activity has been explored in the field of cancer research and other therapeutic applications beyond its antiepileptic properties.
CAS Number | 99-66-1 |
Synonyms | 2-propylpentanoic acid |
Molecular Formula | C8H16O2 |
Purity | ≥95% |
Target | Epigenetics |
Solubility | 10mM in water |
Storage | Store at -20C |
IC50 | 10 uM (Hela, 24h) |
IUPAC Name | 2-propylpentanoic acid |
InChI | InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
InChIKey | NIJJYAXOARWZEE-UHFFFAOYSA-N |
SMILES | CCCC(CCC)C(=O)O |
Reference | <p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |