For research use only. Not for therapeutic Use.
Valpromide（Cat No.:R042990）is an amide derivative of valproic acid, primarily used as an anticonvulsant and mood stabilizer for treating epilepsy and bipolar disorder. It functions by enhancing gamma-aminobutyric acid (GABA) levels in the brain, which helps stabilize neural activity and prevent seizures. Unlike valproic acid, valpromide has a more rapid onset of action, though it may convert partially to valproic acid in the body. Its dual role in mood regulation and seizure control makes valpromide valuable in neuropsychiatric treatment, particularly for patients with overlapping mood and seizure disorders.
| Catalog Number | R042990 |
| CAS Number | 2430-27-5 |
| Synonyms | 2-Propylpentamide; 2-Propylvaleramide; Depamid; Depamide; Di-n-propylacetamide; Dipropylacetamide; α-Propylvaleramide |
| Molecular Formula | C₈H₁₇NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-propylpentanamide |
| InChI | InChI=1S/C8H17NO/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H2,9,10) |
| InChIKey | OMOMUFTZPTXCHP-UHFFFAOYSA-N |
| SMILES | CCCC(CCC)C(=O)N |
