For research use only. Not for therapeutic Use.
Vamidothion sulfone (Cat.No:I037957) is a metabolite of the organophosphorus insecticide vamidothion. It is formed through the oxidation of vamidothion in the environment. Vamidothion sulfone has also been studied as a marker for the exposure to vamidothion. Its toxicological properties and potential environmental impact are subjects of ongoing research.
| Catalog Number | I037957 |
| CAS Number | 70898-34-9 |
| Synonyms | Vamidothion sulfone; |
| Molecular Formula | C8H18NO6PS2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | Phosphorothioic acid, O,O-dimethyl S-(2-((1-methyl-2-(methylamino)-2-oxoethyl)sulfonyl)ethyl) ester |
| InChI | InChI=1S/C8H18NO6PS2/c1-7(8(10)9-2)18(11,12)6-5-15-16(17,13-3)14-4/h7H,5-6H2,1-4H3,(H,9,10)/t7-/m0/s1 |
| InChIKey | HNRQYFFHOBWJPZ-ZETCQYMHSA-N |
| SMILES | S=P(OC)(OCCS(=O)([C@@H](C)C(NC)=O)=O)OC |
