For research use only. Not for therapeutic Use.
Vanillic Acid(Cat No.:R050768), is a natural compound derived from vanillin, the principal component responsible for the flavor and aroma of vanilla beans. Vanillic Acid is a phenolic acid and is found in various plant sources, including fruits, vegetables, and spices. It is used as a flavoring agent in the food industry and as an intermediate in the synthesis of other compounds in the pharmaceutical and chemical industries. Additionally, Vanillic Acid exhibits antioxidant and anti-inflammatory properties, making it a subject of interest in research for potential health benefits.
CAS Number | 121-34-6 |
Synonyms | 4-Hydroxy-3-methoxybenzoic Acid; 2-Methoxy-4-carboxyphenol; 3-Methoxy-4-hydroxybenzoic Acid; NSC 3987; NSC 674322; VA; m-Methoxy-p-hydroxy-benzoic Acid; |
Molecular Formula | C8H8O4 |
Purity | ≥95% |
Target | Anti-infection |
Storage | RT |
IUPAC Name | 4-hydroxy-3-methoxybenzoic acid |
InChI | InChI=1S/C8H8O4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4,9H,1H3,(H,10,11) |
InChIKey | WKOLLVMJNQIZCI-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)C(=O)O)O |