For research use only. Not for therapeutic Use.
Vanillin-13C(Cat No.:R013152)is a high-purity isotopically labeled compound essential for advanced biochemical and pharmaceutical research. Featuring a carbon-13 atom, this labeled version of vanillin is crucial for studying flavor chemistry, metabolic pathways, and synthetic processes. It enhances precision and accuracy in analytical techniques such as mass spectrometry and NMR spectroscopy, ensuring reliable and reproducible results. Ideal for food science, drug development, and organic synthesis, Vanillin-13C integrates seamlessly into existing research protocols, providing a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 86884-84-6 |
Synonyms | 4-Hydroxy-3-(methoxy-13C)benzaldehyde; 2-(Methoxy-13C)-4-formylphenol; p-Vanillin-13C; 3-(Methoxy-13C)-4-hydroxybenzaldehyde; 4-Formyl-2-(methoxy-13C)?phenol; 4-Hydroxy-m-anisaldehyde-13C; H 0264-13C; Lioxin-13C; NSC 15351-13C; NSC 403658-13C; Rhovan |
Molecular Formula | C8H8O3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 4-hydroxy-3-(113C)methoxybenzaldehyde |
InChI | InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3/i1+1 |
InChIKey | MWOOGOJBHIARFG-OUBTZVSYSA-N |
SMILES | [13CH3]OC1=C(C=CC(=C1)C=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |