Vanillin-13C6 is a stable isotope-labeled form of vanillin, enriched with six 13C atoms. This high-purity compound is essential for advanced biochemical and pharmaceutical research, particularly in studying metabolic pathways, flavor chemistry, and synthetic applications. Its precise isotope labeling ensures accurate and reliable analytical results. Vanillin-13C6 is ideal for investigations involving aroma compounds, metabolic studies, and tracer experiments, providing a robust and consistent tool for high-precision scientific investigations, seamlessly integrating into existing research protocols.
| Catalog Number | R013219 |
| CAS Number | 201595-58-6 |
| Synonyms | 4-Hydroxy-3-methoxybenzaldehyde-13C6; 2-Methoxy-4-formylphenol-13C6; p-Vanillin-13C6; 3-Methoxy-4-hydroxybenzaldehyde-13C6; 4-Formyl-2-methoxy?phenol-13C6; 4-Hydroxy-m-anisaldehyde-13C6; H 0264-13C6; Lioxin-13C6; NSC 15351-13C6; NSC 403658-13C6; Rhov |
| Molecular Formula | C8H8O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-hydroxy-3-methoxybenzaldehyde |
| InChI | InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3/i2+1,3+1,4+1,6+1,7+1,8+1 |
| InChIKey | MWOOGOJBHIARFG-BOCFXHSMSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)O |
