For research use only. Not for therapeutic Use.
Vanoxerine dihydrochloride（Cat No.:I004536）, also known as RTI-113, is a dopamine reuptake inhibitor and a research chemical used primarily in the study of neurotransmitter systems. It works by blocking the dopamine transporter (DAT), leading to increased levels of dopamine in the brain, which can affect mood, motivation, and motor function. Vanoxerine has been investigated for its potential therapeutic effects in conditions like Parkinson’s disease and attention-deficit hyperactivity disorder (ADHD), where dopaminergic activity is altered. Additionally, it is used in research to explore the role of dopamine in addiction and neurodegenerative disorders.
| Catalog Number | I004536 |
| CAS Number | 67469-78-7 |
| Synonyms | 1-(2-(bis(4-fluorophenyl)methoxy)ethyl)-4-(3-phenylpropyl)piperazine dihydrochloride |
| Molecular Formula | C28H34Cl2F2N2O |
| Purity | ≥95% |
| Target | Dopamine Transporter |
| Solubility | DMSO: ≤ 9.4 mg/mL |
| Storage | Store at -20C |
| IUPAC Name | 1-[2-[bis(4-fluorophenyl)methoxy]ethyl]-4-(3-phenylpropyl)piperazine;dihydrochloride |
| InChI | InChI=1S/C28H32F2N2O.2ClH/c29-26-12-8-24(9-13-26)28(25-10-14-27(30)15-11-25)33-22-21-32-19-17-31(18-20-32)16-4-7-23-5-2-1-3-6-23;;/h1-3,5-6,8-15,28H,4,7,16-22H2;2*1H |
| InChIKey | MIBSKSYCRFWIRU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCC2=CC=CC=C2)CCOC(C3=CC=C(C=C3)F)C4=CC=C(C=C4)F.Cl.Cl |
| Reference | </br>1:[Pharmacological effects of the novel dopamine uptake inhibitor 1-[2-[bis(4-fluorophenyl)-methoxy]ethyl]-4-(3-phenylpropyl) piperazine dihydrochloride (I-893) on the central nervous system]. Nagase T, Hotta K, Morita S, Sakai K, Yamane M, Omote M, Mizusawa H.Nihon Yakurigaku Zasshi. 1991 Aug;98(2):121-41. Japanese. PMID: 1833294 </br>2:[Effects of 1-[2-[bis(fluorophenyl)methoxy]ethyl]-4-(3-phenylpropyl) piperazine dihydrochloride (I-893) on turnover of dopamine and norepinephrine in the brain]. Nagase T, Ishiko J, Takaori S.Nihon Yakurigaku Zasshi. 1987 Aug;90(2):105-14. Japanese. PMID: 3119439 |
