For research use only. Not for therapeutic Use.
Vapreotide（Cat No.:I000190）is a synthetic octapeptide that acts as a somatostatin analogue, mimicking the effects of the naturally occurring hormone somatostatin. It works by binding to somatostatin receptors, particularly SST2 and SST5, to inhibit the secretion of several hormones, including growth hormone, insulin, glucagon, and serotonin. Vapreotide is primarily investigated for treating conditions like acromegaly, neuroendocrine tumors, and variceal bleeding in cirrhosis. It has been shown to reduce hormone-related symptoms and improve patient outcomes. Ongoing clinical trials are evaluating its safety, efficacy, and potential for broader therapeutic applications in endocrinological and gastrointestinal disorders.
| Catalog Number | I000190 |
| CAS Number | 103222-11-3 |
| Molecular Formula | C57H70N12O9S2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | H2O |
| Storage | Store at -20°C |
| IUPAC Name | 10-(4-aminobutyl)-N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-19-[(2-amino-3-phenylpropanoyl)amino]-16-[(4-hydroxyphenyl)methyl]-13-(1H-indol-3-ylmethyl)-6,9,12,15,18-pentaoxo-7-propan-2-yl-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carboxamide |
| InChI | InChI=1S/C57H70N12O9S2/c1-32(2)49-57(78)68-48(55(76)64-44(50(60)71)26-35-28-61-41-16-8-6-14-38(35)41)31-80-79-30-47(67-51(72)40(59)24-33-12-4-3-5-13-33)56(77)65-45(25-34-19-21-37(70)22-20-34)53(74)66-46(27-36-29-62-42-17-9-7-15-39(36)42)54(75)63-43(52(73)69-49)18-10-11-23-58/h3-9,12-17,19-22,28-29,32,40,43-49,61-62,70H,10-11,18,23-27,30-31,58-59H2,1-2H3,(H2,60,71)(H,63,75)(H,64,76)(H,65,77)(H,66,74)(H,67,72)(H,68,78)(H,69,73) |
| InChIKey | SWXOGPJRIDTIRL-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(=O)NC(CSSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCCN)CC2=CNC3=CC=CC=C32)CC4=CC=C(C=C4)O)NC(=O)C(CC5=CC=CC=C5)N)C(=O)NC(CC6=CNC7=CC=CC=C76)C(=O)N |
| Reference | <p style=/line-height:25px/> </p> |
