For research use only. Not for therapeutic Use.
Vatalanib (CAT: I002634) is an oral, small-molecule tyrosine kinase inhibitor (TKI) that selectively targets vascular endothelial growth factor receptors (VEGFR-1, VEGFR-2, and VEGFR-3), as well as platelet-derived growth factor receptors (PDGFRs) and c-Kit. By inhibiting these receptors, Vatalanib disrupts angiogenesis, the process of new blood vessel formation, which is crucial for tumor growth and metastasis. This anti-angiogenic activity makes Vatalanib a promising therapeutic candidate in oncology research, particularly for treating solid tumors and cancers like colorectal cancer, glioblastoma, and non-small cell lung cancer (NSCLC).
| Catalog Number | I002634 |
| CAS Number | 212141-54-3 |
| Synonyms | N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine |
| Molecular Formula | C₂₀H₁₅ClN₄ |
| Purity | ≥95% |
| Target | VEGFR |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 37 nM (VEGFR2/KDR) [1] |
| IUPAC Name | N-(4-chlorophenyl)-4-(pyridin-4-ylmethyl)phthalazin-1-amine |
| InChI | InChI=1S/C20H15ClN4/c21-15-5-7-16(8-6-15)23-20-18-4-2-1-3-17(18)19(24-25-20)13-14-9-11-22-12-10-14/h1-12H,13H2,(H,23,25) |
| InChIKey | YCOYDOIWSSHVCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN=C2NC3=CC=C(C=C3)Cl)CC4=CC=NC=C4 |
