For research use only. Not for therapeutic Use.
VBY-825(Cat No.:I001187)is a potent and selective inhibitor of cathepsin proteases, primarily used in cancer and fibrosis research. This compound effectively blocks the activity of cathepsin B, L, and S, enzymes involved in the degradation of extracellular matrix and promotion of tumor progression and metastasis. Its high specificity and efficacy ensure reliable results in preclinical studies. VBY-825 is valuable for developing new therapeutic strategies targeting cathepsin-related pathways, offering potential treatments for various cancers and fibrotic diseases. It significantly contributes to advancements in understanding and combating these complex conditions.
CAS Number | 1310340-58-9 |
Molecular Formula | C23H29F4N3O5S |
Purity | ≥95% |
Target | Cathepsin |
Solubility | 10 mM in DMSO |
Storage | 3 years -20C powder |
IUPAC Name | (3S)-N-cyclopropyl-3-[[(2R)-3-(cyclopropylmethylsulfonyl)-2-[[(1S)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]propanoyl]amino]-2-oxopentanamide |
InChI | InChI=1S/C23H29F4N3O5S/c1-2-17(19(31)22(33)28-16-9-10-16)30-21(32)18(12-36(34,35)11-13-3-4-13)29-20(23(25,26)27)14-5-7-15(24)8-6-14/h5-8,13,16-18,20,29H,2-4,9-12H2,1H3,(H,28,33)(H,30,32)/t17-,18-,20-/m0/s1 |
InChIKey | PPUXXDKQNAHHON-BJLQDIEVSA-N |
SMILES | CCC(C(=O)C(=O)NC1CC1)NC(=O)C(CS(=O)(=O)CC2CC2)NC(C3=CC=C(C=C3)F)C(F)(F)F |