For research use only. Not for therapeutic Use.
Vedaprofen is a non-steroidal anti-inflammatory drug (NSAID) commonly used in veterinary medicine to combat pain, inflammation, and fever associated with acute and chronic musculoskeletal disorders in horses and dogs. In addition to inhibiting COX and reducing prostaglandin H<sub>2</sub> synthesis, vedaprofen is reported to block the activity of the <em>E. coli</em> DNA polymerase III β subunit, preventing DNA replication and repair.
| Catalog Number | R010071 |
| CAS Number | 71109-09-6 |
| Synonyms | 4-Cyclohexyl-α-methyl-1-naphthaleneacetic Acid; 2-(4-Cyclohexil-1-naphthyl)-propionic Acid; CERM 10202; PM-150; Quadrisol; |
| Molecular Formula | C19H22O2 |
| Purity | ≥95% |
| Target | COX |
| Storage | -20°C |
| IUPAC Name | 2-(4-cyclohexylnaphthalen-1-yl)propanoic acid |
| InChI | InChI=1S/C19H22O2/c1-13(19(20)21)15-11-12-16(14-7-3-2-4-8-14)18-10-6-5-9-17(15)18/h5-6,9-14H,2-4,7-8H2,1H3,(H,20,21) |
| InChIKey | VZUGVMQFWFVFBX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C2=CC=CC=C21)C3CCCCC3)C(=O)O |
