For research use only. Not for therapeutic Use.
Velnacrine-d4 hydrochloride（Cat No.:I043921）is a deuterated analog of Velnacrine, a compound originally developed as a potential treatment for Alzheimer’s disease and other neurodegenerative disorders. The “d4” in its name indicates the incorporation of four deuterium atoms, which are heavier isotopes of hydrogen. This modification helps to improve the compound’s stability and pharmacokinetic properties, making it suitable for detailed research studies. Velnacrine-d4 hydrochloride is primarily used in scientific investigations to study the metabolism, pharmacology, and potential therapeutic applications of Velnacrine, particularly in neurodegeneration and cognitive function.
| CAS Number | 1246816-08-9 |
| Synonyms | 9-amino-5,6,7,8-tetradeuterio-1,2,3,4-tetrahydroacridin-1-ol;hydrochloride |
| Molecular Formula | C13H11D4ClN2O |
| Purity | ≥95% |
| IUPAC Name | 9-amino-5,6,7,8-tetradeuterio-1,2,3,4-tetrahydroacridin-1-ol;hydrochloride |
| InChI | InChI=1S/C13H14N2O.ClH/c14-13-8-4-1-2-5-9(8)15-10-6-3-7-11(16)12(10)13;/h1-2,4-5,11,16H,3,6-7H2,(H2,14,15);1H/i1D,2D,4D,5D; |
| InChIKey | IJWCYOSTVLKCCX-XLJCJYTQSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C3C(CCCC3=N2)O)N)[2H])[2H].Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
