For research use only. Not for therapeutic Use.
VER-155008 (Cat No.:I0005032) is a potent and selective inhibitor of the heat shock protein 70 (Hsp70) family of proteins. It acts by binding to the ATPase domain of Hsp70, preventing its ATPase activity and disrupting its chaperone function. Hsp70 is involved in protein folding, stability, and degradation, and plays a crucial role in cellular stress response. By inhibiting Hsp70, VER-155008 can impact various cellular processes and pathways, making it a valuable tool in research and potentially offering therapeutic applications in diseases where Hsp70 is dysregulated, such as cancer and neurodegenerative disorders.
CAS Number | 1134156-31-2 |
Synonyms | 4-[[(2R,3S,4R,5R)-5-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzonitrile |
Molecular Formula | C25H23Cl2N7O4 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | DMSO: ≥ 37 mg/mL |
Storage | Store at -20°C |
IC50 | 5.3-14.4 uM(GI50); 80 nM(Kd) |
IUPAC Name | 4-[[(2R,3S,4R,5R)-5-[6-amino-8-[(3,4-dichlorophenyl)methylamino]purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxymethyl]benzonitrile |
InChI | InChI=1S/C25H23Cl2N7O4/c26-16-6-5-15(7-17(16)27)9-30-25-33-19-22(29)31-12-32-23(19)34(25)24-21(36)20(35)18(38-24)11-37-10-14-3-1-13(8-28)2-4-14/h1-7,12,18,20-21,24,35-36H,9-11H2,(H,30,33)(H2,29,31,32)/t18-,20-,21-,24-/m1/s1 |
InChIKey | ZXGGCBQORXDVTE-UMCMBGNQSA-N |
SMILES | C1=CC(=CC=C1COC[C@@H]2[C@H]([C@H]([C@@H](O2)N3C4=NC=NC(=C4N=C3NCC5=CC(=C(C=C5)Cl)Cl)N)O)O)C#N |
Reference | 1. Exp Biol Med (Maywood). 2014 May;239(5):638-45. doi: 10.1177/1535370214527899. |