For research use only. Not for therapeutic Use.
Verapamil-d6 hydrochloride is a deuterated form of verapamil, a calcium channel blocker used to treat conditions such as hypertension, angina, and certain types of cardiac arrhythmias. In this deuterated version, six hydrogen atoms are replaced with deuterium, a stable isotope of hydrogen. This modification can provide advantages in pharmacokinetic studies, as the deuterium atoms can affect the metabolism of the drug, potentially leading to improved drug stability and a longer half-life. Verapamil-d6 hydrochloride is often used in research to study the drug’s pharmacokinetics and dynamics, as well as in drug metabolism studies using mass spectrometry.
| Catalog Number | R004045 |
| CAS Number | 1185032-80-7 |
| Synonyms | 2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)pentanenitrile;hydrochloride |
| Molecular Formula | C27H33D6ClN2O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C27H38N2O4.ClH/c1-20(2)27(19-28,22-10-12-24(31-5)26(18-22)33-7)14-8-15-29(3)16-13-21-9-11-23(30-4)25(17-21)32-6;/h9-12,17-18,20H,8,13-16H2,1-7H3;1H/i1D3,2D3; |
| InChIKey | DOQPXTMNIUCOSY-TXHXQZCNSA-N |
| SMILES | CC(C)C(CCCN(C)CCC1=CC(=C(C=C1)OC)OC)(C#N)C2=CC(=C(C=C2)OC)OC.Cl |
