For research use only. Not for therapeutic Use.
Veratrole is a high-purity aromatic compound used in organic synthesis and industrial applications. Also known as 1,2-dimethoxybenzene, this compound is essential for studying electrophilic aromatic substitution reactions and as a precursor in the synthesis of pharmaceuticals and fine chemicals. Its precise composition ensures reliable and reproducible results, making it indispensable for advanced chemical synthesis and material science applications. Ideal for experimental setups, Veratrole enhances research accuracy and efficiency.
| Catalog Number | R022484 |
| CAS Number | 91-16-7 |
| Synonyms | 1,2-Dimethoxybenzene; 2-Methoxyanisole; Catechol Dimethyl Ether; Methylguaiacol; NSC 16934; O,O-Dimethylcatechol; Pyrocatechol Dimethyl Ether; Veratrol; Veratrole; o-Dimethoxybenzene; o-Hydroquinone Dimethyl Ether; o-Methoxyanisole |
| Molecular Formula | C8H10O2 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | -20°C |
| IUPAC Name | 1,2-dimethoxybenzene |
| InChI | InChI=1S/C8H10O2/c1-9-7-5-3-4-6-8(7)10-2/h3-6H,1-2H3 |
| InChIKey | ABDKAPXRBAPSQN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1OC |
