Verbascoside（Cat No.:I004311）is a phenylpropanoid glycoside found in various plants, known for its antioxidant, anti-inflammatory, and antimicrobial properties. This compound has been studied for its potential health benefits, including cardiovascular protection and neuroprotection. Verbascoside exerts its effects by modulating oxidative stress and inflammatory responses, making it a valuable candidate in research related to chronic diseases. It has also shown promise in enhancing immune function and protecting against cellular damage. Its diverse biological activities position verbascoside as an important subject in phytochemistry and the development of natural therapeutic agents.
| Catalog Number | I004311 |
| CAS Number | 61276-17-3 |
| Molecular Formula | C29H36O15 |
| Purity | ≥95% |
| Solubility | DMSO: ≥ 6.3 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | [(2R,3R,4R,5R,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-5-hydroxy-2-(hydroxymethyl)-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| InChI | InChI=1S/C29H36O15/c1-13-22(36)23(37)24(38)29(41-13)44-27-25(39)28(40-9-8-15-3-6-17(32)19(34)11-15)42-20(12-30)26(27)43-21(35)7-4-14-2-5-16(31)18(33)10-14/h2-7,10-11,13,20,22-34,36-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23+,24+,25+,26+,27+,28+,29-/m0/s1 |
| InChIKey | FBSKJMQYURKNSU-ZLSOWSIRSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2OC(=O)/C=C/C3=CC(=C(C=C3)O)O)CO)OCCC4=CC(=C(C=C4)O)O)O)O)O)O |
| Reference | <p style=/line-height:25px/> |
