For research use only. Not for therapeutic Use.
Verbenalin(Cat No.:R066045), exhibits anti-inflammatory, anti-fungal, anti-viral, and other beneficial activities. This compound is of interest in the study of prostatitis due to its potential therapeutic effects. Additionally, verbenalin has been found to reduce cerebral ischemia-reperfusion injury, suggesting its neuroprotective properties. The diverse pharmacological actions of verbenalin make it a promising candidate for further research and exploration in various fields, offering potential applications in the treatment of inflammatory conditions and neurological disorders.
Catalog Number | R066045 |
CAS Number | 548-37-8 |
Molecular Formula | C17H24O10 |
Purity | ≥95% |
Target | SARS-CoV |
Storage | 2-8°C |
IUPAC Name | methyl (1S,4aS,7S,7aR)-7-methyl-5-oxo-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4a,6,7,7a-tetrahydro-1H-cyclopenta[c]pyran-4-carboxylate |
InChI | InChI=1S/C17H24O10/c1-6-3-8(19)11-7(15(23)24-2)5-25-16(10(6)11)27-17-14(22)13(21)12(20)9(4-18)26-17/h5-6,9-14,16-18,20-22H,3-4H2,1-2H3/t6-,9+,10+,11-,12+,13-,14+,16-,17-/m0/s1 |
InChIKey | HLXRWTJXGMHOFN-XJSNKYLASA-N |
SMILES | C[C@H]1CC(=O)[C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |