For research use only. Not for therapeutic Use.
Verdiperstat is an investigational drug that acts as a myeloperoxidase (MPO) inhibitor, designed to reduce inflammation and oxidative stress in the brain. MPO is an enzyme that contributes to the production of reactive oxygen species, which can exacerbate neuroinflammation and neurodegeneration. Verdiperstat is being studied for its potential to treat neurodegenerative disorders, including multiple system atrophy (MSA) and amyotrophic lateral sclerosis (ALS). By inhibiting MPO, it aims to slow disease progression and protect neurons from further damage.
| Catalog Number | I010018 |
| CAS Number | 890655-80-8 |
| Synonyms | 1-(2-propan-2-yloxyethyl)-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| Molecular Formula | C11H15N3O2S |
| Purity | ≥95% |
| InChI | InChI=1S/C11H15N3O2S/c1-7(2)16-6-5-14-8-3-4-12-9(8)10(15)13-11(14)17/h3-4,7,12H,5-6H2,1-2H3,(H,13,15,17) |
| InChIKey | FVJCUZCRPIMVLB-UHFFFAOYSA-N |
| SMILES | CC(C)OCCN1C2=C(C(=O)NC1=S)NC=C2 |
