For research use only. Not for therapeutic Use.
Verlukast (CAS 120443-16-5), also known as MK-0679, is a (R)-enantiomer of MK-571 and a potent and selective LTD4 receptor antagonist. Verlukast showed [3H]leukotriene D4 binding in guinea-pig (IC50 = 3.1 +/- 0.5 nM) and human (IC50 = 8.0 +/- 3.0 nM) lung homogenates and dimethyl sulfoxide differentiated U937 cell membrane preparations (IC50 = 10.7 +/- 1.6 nM) but is essentially inactive versus [3H]leukotriene C4 binding in guinea-pig lung homogenates (IC50 values of 19 and 33 microM). Verlukast was in clinical development for the treatment of asthma and related diseases. (last updated: 8/8/2016)
| Catalog Number | R007867 |
| CAS Number | 120443-16-5 |
| Synonyms | 3-[[(R)-[3-[(1E)-2-(7-Chloro-2-quinolinyl)ethenyl]phenyl][[3-(dimethylamino)-3-oxopropyl]thio]methyl]thio]-propanoic Acid; L 668019; MK 679; R-(-)-MK 571; |
| Molecular Formula | C26H27ClN2O3S2 |
| Purity | ≥95% |
| Target | Leukotriene Receptor |
| Solubility | DMSO |
| Storage | Store at -20°C |
| Overview of Clinical Research | <span style="color:#000000;"><span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">Verlukast is a Leukotriene D4 receptor antagonist.</span></span></span> |
| IUPAC Name | 3-[(R)-[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-[3-(dimethylamino)-3-oxopropyl]sulfanylmethyl]sulfanylpropanoic acid |
| InChI | InChI=1S/C26H27ClN2O3S2/c1-29(2)24(30)12-14-33-26(34-15-13-25(31)32)20-5-3-4-18(16-20)6-10-22-11-8-19-7-9-21(27)17-23(19)28-22/h3-11,16-17,26H,12-15H2,1-2H3,(H,31,32)/b10-6+/t26-/m1/s1 |
| InChIKey | AXUZQJFHDNNPFG-LHAVAQOQSA-N |
| SMILES | CN(C)C(=O)CCSC(C1=CC=CC(=C1)C=CC2=NC3=C(C=CC(=C3)Cl)C=C2)SCCC(=O)O |
| Reference | <br /> |
