For research use only. Not for therapeutic Use.
Verrucrin J (Cat No.: R068762) is a bioactive compound derived from marine sources, specifically certain marine fungi. It exhibits notable pharmacological activities, including antimicrobial, antifungal, and anticancer properties. Verrucrin J has shown promise in inhibiting the growth of cancer cells, particularly by affecting cell cycle regulation and inducing apoptosis. Additionally, its antimicrobial effects make it a potential candidate for addressing various infections. Research into Verrucrin J is ongoing to explore its therapeutic potential in treating cancer, infections, and other diseases.
CAS Number | 4643-58-7 |
Synonyms | muconomycin B; verrucarin J |
Molecular Formula | C27H38O2 |
Purity | ≥95% |
Target | Anti-infection |
Storage | Store at 0-8 °C |
IUPAC Name | (1R,3R,8R,12E,18E,20Z,24R,25S,26S)-5,13,25-trimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,12,18,20-tetraene-26,2'-oxirane]-11,17,22-trione |
InChI | 1S/C27H32O8/c1-17-8-10-26-15-32-24(30)13-18(2)9-11-31-22(28)6-4-5-7-23(29)35-19-14-21(34-20(26)12-17)27(16-33-27)25(19,26)3/h4-7,12-13,19-21H,8-11,14-16H2,1-3H3/b6-4+,7-5-,18-13+/t19-,20-,21-,25-,26-,27+/m1/s1 |
InChIKey | GXCGYHWSYNQVHU-XJRZFDMGSA-N |
SMILES | CC1=CC2C3(CC1)COC(=O)C=C(CCOC(=O)C=CC=CC(=O)OC4C3(C5(CO5)C(C4)O2)C)C |