For research use only. Not for therapeutic Use.
Vibegron（Cat No.:I010025）is a selective beta-3 adrenergic receptor agonist used to treat overactive bladder (OAB) symptoms, such as urinary urgency, frequency, and incontinence. By stimulating beta-3 receptors in the bladder’s detrusor muscle, Vibegron relaxes the muscle, allowing for increased bladder capacity and reduced urgency. Its targeted mechanism provides effective symptom relief with fewer side effects compared to other OAB treatments. Vibegron offers a convenient, once-daily oral therapy that improves quality of life for patients suffering from OAB, reducing the need for frequent urination and enhancing bladder control.
| Catalog Number | I010025 |
| CAS Number | 1190389-15-1 |
| Synonyms | MK-4618; MK 4618; MK4618; Vibegron;(S)-N-(4-(((2S,5R)-5-((R)-hydroxy(phenyl)methyl)pyrrolidin-2-yl)methyl)phenyl)-4-oxo-4,6,7,8-tetrahydropyrrolo[1,2-a]pyrimidine-6-carboxamide |
| Molecular Formula | C26H28N4O3 |
| Purity | 98% |
| Target | Neuronal Signaling |
| Target Protein | P13945 |
| Solubility | Soluble in DMSO, not in water |
| Appearance | Solid |
| Storage | Dry, dark and at 2 - 8 °C for six months or -20°C for two years. |
| IC50 | EC50:1.1 nM (β3 adrenoceptor) |
| IUPAC Name | (6S)-N-[4-[[(2S,5R)-5-[(R)-hydroxy(phenyl)methyl]pyrrolidin-2-yl]methyl]phenyl]-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carboxamide |
| InChI | InChI=1S/C26H28N4O3/c31-24-14-15-27-23-13-12-22(30(23)24)26(33)29-19-8-6-17(7-9-19)16-20-10-11-21(28-20)25(32)18-4-2-1-3-5-18/h1-9,14-15,20-22,25,28,32H,10-13,16H2,(H,29,33)/t20-,21+,22-,25+/m0/s1 |
| InChIKey | DJXRIQMCROIRCZ-XOEOCAAJSA-N |
| SMILES | C1C[C@@H](N[C@@H]1CC2=CC=C(C=C2)NC(=O)[C@@H]3CCC4=NC=CC(=O)N34)[C@@H](C5=CC=CC=C5)O |
| Reference | <br /> |
