For research use only. Not for therapeutic Use.
Vilazodone-d8(Cat No.:S000379) is a deuterated form of vilazodone, an antidepressant used primarily to treat major depressive disorder. In this modified version, eight hydrogen atoms are replaced with deuterium. The inclusion of deuterium in vilazodone’s structure allows for detailed studies of its pharmacokinetics and metabolic pathways, providing insights into its absorption, distribution, metabolism, and excretion. This isotopic labeling is crucial for understanding how vilazodone interacts within the body and can lead to improved dosing regimens and enhanced therapeutic efficacy, potentially reducing side effects and optimizing patient outcomes.
CAS Number | 1794789-93-7 |
Molecular Formula | C26H19D8N5O2 |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1-benzofuran-2-carboxamide |
InChI | InChI=1S/C26H27N5O2/c27-16-18-4-6-23-22(13-18)19(17-29-23)3-1-2-8-30-9-11-31(12-10-30)21-5-7-24-20(14-21)15-25(33-24)26(28)32/h4-7,13-15,17,29H,1-3,8-12H2,(H2,28,32)/i9D2,10D2,11D2,12D2 |
InChIKey | SGEGOXDYSFKCPT-PMCMNDOISA-N |
SMILES | C1CN(CCN1CCCCC2=CNC3=C2C=C(C=C3)C#N)C4=CC5=C(C=C4)OC(=C5)C(=O)N |