For research use only. Not for therapeutic Use.
Vinadine(Cat No.:M014160) is a synthetic compound used primarily as a veterinary drug. It belongs to the class of phenothiazine antiparasitics, which are effective in treating a wide range of parasitic infections. Vinadine is particularly used for its antiprotozoal and anthelmintic properties, making it a valuable tool in the control of internal and external parasites in livestock and domestic animals. This drug operates by interfering with the parasites’ neurotransmission, leading to their paralysis and eventual death. Its use contributes to the overall health and productivity of treated animals by reducing parasite-related diseases.
CAS Number | 58-36-6 |
Synonyms | 10,10’-bis(Phenoxyarsinyl)oxide;10,10’-Oxidiphenoxarsine;10,10’-oxybis-10h-phenoxarsin;10,10’-oxybis-phenoxyarsin;10,10’-oxybisphenoxyarsine;10,10’-oxybis-Phenoxyarsine;10,10’-oxybisphenoxy-arsine;10,10’-oxydi-phenoxarsin |
Molecular Formula | C24H16As2O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 10-phenoxarsinin-10-yloxyphenoxarsinine |
InChI | InChI=1S/C24H16As2O3/c1-5-13-21-17(9-1)25(18-10-2-6-14-22(18)27-21)29-26-19-11-3-7-15-23(19)28-24-16-8-4-12-20(24)26/h1-16H |
InChIKey | VCRZAKVGPJFABU-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)OC3=CC=CC=C3[As]2O[As]4C5=CC=CC=C5OC6=CC=CC=C64 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |