For research use only. Not for therapeutic Use.
Vinyl myristate (stabilized with MEHQ)（Cat No.:I041483）is an ester derived from myristic acid and vinyl alcohol. The “MEHQ” refers to methylhydroquinone, a stabilizer added to prevent polymerization during storage and handling. This compound is commonly used in the production of plastics, resins, and coatings, due to its ability to undergo polymerization when initiated. Vinyl myristate is particularly valuable in the manufacture of adhesives, films, and other polymeric materials. The stabilizer (MEHQ) helps extend shelf life and improve handling safety by inhibiting unwanted reactions, making it ideal for industrial and commercial applications.
| Catalog Number | I041483 |
| CAS Number | 5809-91-6 |
| Synonyms | ethenyl tetradecanoate |
| Molecular Formula | C16H30O2 |
| Purity | ≥95% |
| IUPAC Name | ethenyl tetradecanoate |
| InChI | InChI=1S/C16H30O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)18-4-2/h4H,2-3,5-15H2,1H3 |
| InChIKey | ZQZUENMXBZVXIZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCC(=O)OC=C |
