For research use only. Not for therapeutic Use.
| Catalog Number | M069542 |
| CAS Number | 129-24-8 |
| Synonyms | NSC 656625 |
| Molecular Formula | C15H11NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-hydroxy-4-phenyl-1H-quinolin-2-one |
| InChI | InChI=1S/C15H11NO2/c17-14-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)16-15(14)18/h1-9,17H,(H,16,18) |
| InChIKey | QSRVMXWVVMILDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC3=CC=CC=C32)O |
| Reference | The isolation and some chemical properties of viridicatin, a metabolic product of Penicillium viridicatum, Westling, Cunningham K.G. and Freeman G.G. Biochem J. 1953, 53_328.<br/><br/>Studies in the biochemistry of microorganisms. 93. Cyclopenin, a nitrogen-containing metabolic product of Penicillium cyclopium Westling. Bracken A. et al. Biochem J. 1954, 57, 587.</span></p> |
