For research use only. Not for therapeutic Use.
Viridicatin(Cat No.:M069542)is a natural alkaloid derived from fungal sources, particularly Penicillium species. It exhibits a range of bioactive properties, including antimicrobial, anticancer, and anti-inflammatory activities. Viridicatin functions by interfering with cellular processes such as DNA synthesis and signaling pathways, making it a valuable compound in drug discovery and natural product research. Its unique chemical structure and diverse pharmacological effects have spurred interest in its potential therapeutic applications. Additionally, viridicatin is studied for its role in understanding fungal secondary metabolites and their contributions to medicinal chemistry.
CAS Number | 129-24-8 |
Synonyms | NSC 656625 |
Molecular Formula | C15H11NO2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | 3-hydroxy-4-phenyl-1H-quinolin-2-one |
InChI | InChI=1S/C15H11NO2/c17-14-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)16-15(14)18/h1-9,17H,(H,16,18) |
InChIKey | QSRVMXWVVMILDI-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC3=CC=CC=C32)O |
Reference | The isolation and some chemical properties of viridicatin, a metabolic product of Penicillium viridicatum, Westling, Cunningham K.G. and Freeman G.G. Biochem J. 1953, 53_328.<br/><br/>Studies in the biochemistry of microorganisms. 93. Cyclopenin, a nitrogen-containing metabolic product of Penicillium cyclopium Westling. Bracken A. et al. Biochem J. 1954, 57, 587.</span></p> |