For research use only. Not for therapeutic Use.
Viridicatol(Cat No.:M057610) is a natural compound found in certain fungi and plants. Its mode of action involves being a secondary metabolite with potential biological activities. Pharmacologically, viridicatol has been studied for its various effects, including antifungal and antioxidant properties. It has shown promise in preclinical studies, demonstrating its potential as a natural antifungal agent to inhibit the growth of certain fungi. Additionally, its antioxidant activity suggests potential applications in reducing oxidative stress and protecting cells from damage caused by free radicals.
| Catalog Number | M057610 |
| CAS Number | 14484-44-7 |
| Molecular Formula | C15H11NO3 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | -20°C |
| IUPAC Name | 3-hydroxy-4-(3-hydroxyphenyl)-1H-quinolin-2-one |
| InChI | InChI=1S/C15H11NO3/c17-10-5-3-4-9(8-10)13-11-6-1-2-7-12(11)16-15(19)14(13)18/h1-8,17-18H,(H,16,19) |
| InChIKey | QIJIOTTYIGBOQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=O)N2)O)C3=CC(=CC=C3)O |
