For research use only. Not for therapeutic Use.
Virodhamine（Cat No.:I042671）is an endogenous lipid compound that acts as an agonist for both the CB1 and CB2 receptors of the endocannabinoid system. It is derived from arachidonic acid and has been studied for its potential role in regulating various physiological processes, including inflammation, pain, and immune response. Virodhamine’s unique profile as a partial agonist suggests that it could offer therapeutic benefits in managing conditions like neuroinflammation, pain, and immune disorders, without the psychoactive effects commonly associated with other cannabinoids, making it a promising target for future therapeutic development.
| CAS Number | 287937-12-6 |
| Synonyms | 2-aminoethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| Molecular Formula | C22H37NO2 |
| Purity | ≥95% |
| IUPAC Name | 2-aminoethyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| InChI | InChI=1S/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(24)25-21-20-23/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-21,23H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | DLHLOYYQQGSXCC-DOFZRALJSA-N |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCCN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
