For research use only. Not for therapeutic Use.
Virstatin(CAT: R066916) is a small-molecule inhibitor that targets the Vibrio cholerae transcriptional activator ToxT, effectively blocking the expression of key virulence genes such as cholera toxin and toxin-coregulated pilus. By preventing the dimerization of ToxT, Virstatin disrupts the pathogenic mechanisms of V. cholerae, offering a novel antivirulence strategy without affecting bacterial viability. This mode of action reduces the likelihood of resistance development compared to traditional antibiotics. Virstatin is widely used in infectious disease research to study bacterial pathogenesis and as a potential lead compound for developing targeted therapies against cholera and other toxin-mediated bacterial infections.
| CAS Number | 88909-96-0 |
| Synonyms | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid |
| Molecular Formula | C16H13NO4 |
| Purity | ≥95% |
| IUPAC Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoic acid |
| InChI | InChI=1S/C16H13NO4/c18-13(19)8-3-9-17-15(20)11-6-1-4-10-5-2-7-12(14(10)11)16(17)21/h1-2,4-7H,3,8-9H2,(H,18,19) |
| InChIKey | ZHXRDXTYPCPBTI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)CCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
