For research use only. Not for therapeutic Use.
Viscidulin III is a naturally occurring flavonoid with significant biological activity, used in pharmaceutical and biochemical research. Known for its potential antioxidant, anti-inflammatory, and anticancer properties, it is essential for studying the therapeutic applications and mechanisms of action of natural compounds. This compound aids in the development of new treatments for various diseases. Researchers rely on Viscidulin III for precise and reliable results in advanced natural product chemistry, drug discovery, and medicinal research, contributing significantly to innovations in health and medicine.
| Catalog Number | R012443 |
| CAS Number | 92519-91-0 |
| Molecular Formula | C17H14O8 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-(3,6-dihydroxy-2-methoxyphenyl)-5,7-dihydroxy-8-methoxychromen-4-one |
| InChI | InChI=1S/C17H14O8/c1-23-15-8(19)4-3-7(18)14(15)12-6-10(21)13-9(20)5-11(22)16(24-2)17(13)25-12/h3-6,18-20,22H,1-2H3 |
| InChIKey | CPFJPTACQDZPLS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)OC)O)O |
