Vitamin D2（Cat No.:I003763） is an essential bioactive compound vital for advanced pharmaceutical and biochemical research. It plays a significant role in calcium and phosphorus homeostasis, bone health, and immune function. This high-purity form of Vitamin D2 is crucial for studying its metabolic pathways, mechanisms of action, and therapeutic potential. It ensures accurate and reliable results in analytical techniques such as mass spectrometry and NMR spectroscopy.
| Catalog Number | I003763 |
| CAS Number | 50-14-6 |
| Synonyms | Calciferol;Ergocalciferol;Fortodyl;Infron;Mulsiferol;NSC 62792;Radiostol;Uvesterol D |
| Molecular Formula | C28H44O |
| Purity | 95% |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(1R,3aS,7aR)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| InChI | InChI=1S/C28H44O/c1-19(2)20(3)9-10-22(5)26-15-16-27-23(8-7-17-28(26,27)6)12-13-24-18-25(29)14-11-21(24)4/h9-10,12-13,19-20,22,25-27,29H,4,7-8,11,14-18H2,1-3,5-6H3/b10-9+,23-12+,24-13-/t20-,22+,25-,26+,27-,28+/m0/s1 |
| InChIKey | MECHNRXZTMCUDQ-RKHKHRCZSA-N |
| SMILES | C[C@H](/C=C/[C@H](C)C(C)C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C |
