For research use only. Not for therapeutic Use.
Vitamin D3-d7(Cat No.:S000557) is a specialized form of vitamin D3, also known as cholecalciferol, crucial for calcium metabolism, bone health, and immune function. The “d7” designation indicates that seven hydrogen atoms in the vitamin D3 molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic substitution enables precise tracking of vitamin D3 metabolism and its distribution in biological systems using advanced analytical techniques like mass spectrometry. Vitamin D3-d7 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating diseases related to vitamin D deficiency or metabolism, such as rickets and osteoporosis.
Catalog Number | S000557 |
CAS Number | 1627523-19-6 |
Molecular Formula | C27H37D7O |
Purity | ≥95% |
IUPAC Name | (1S,3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6,7,7,7-tetradeuterio-6-(trideuteriomethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
InChI | InChI=1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h12-13,19,21,24-26,28H,3,6-11,14-18H2,1-2,4-5H3/b22-12+,23-13-/t21-,24+,25-,26+,27-/m1/s1/i1D3,2D3,19D |
InChIKey | QYSXJUFSXHHAJI-UIEYODRWSA-N |
SMILES | CC(C)CCCC(C)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C |