For research use only. Not for therapeutic Use.
Vitamin K4(Cat No.:I012986) is a synthetic variant of vitamin K, vital for proper blood clotting. This chemically engineered form of vitamin K plays a crucial role in the coagulation cascade, ensuring that our blood can clot effectively when needed to prevent excessive bleeding. By promoting the activation of key proteins involved in clot formation, vitamin K4 contributes to the maintenance of healthy blood clotting mechanisms, helping to prevent hemorrhage and support overall circulatory health. Its synthetic nature allows for precise control and supplementation when necessary, aiding in the treatment of clotting disorders and ensuring optimal blood coagulation.
CAS Number | 573-20-6 |
Molecular Formula | C₁₅H₁₄O₄ |
Purity | ≥95% |
Target | Apoptosis |
Solubility | 10 mM in DMSO |
Storage | Room Temperature |
IUPAC Name | (4-acetyloxy-3-methylnaphthalen-1-yl) acetate |
InChI | InChI=1S/C15H14O4/c1-9-8-14(18-10(2)16)12-6-4-5-7-13(12)15(9)19-11(3)17/h4-8H,1-3H3 |
InChIKey | RYWSYCQQUDFMAU-UHFFFAOYSA-N |
SMILES | CC1=C(C2=CC=CC=C2C(=C1)OC(=O)C)OC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |