For research use only. Not for therapeutic Use.
Vitexin (Cat No.: R016010) is a flavonoid glycoside found in various plants, particularly in Passiflora (passionflower) and Vitex agnus-castus (chaste tree). It is known for its antioxidant, anti-inflammatory, and neuroprotective properties. Vitexin has been studied for its potential therapeutic effects in conditions like anxiety, stress, and neurodegenerative diseases. It may also support cardiovascular health by improving blood circulation and reducing blood pressure. Additionally, vitexin has shown potential in anticancer and anti-diabetic research.
| CAS Number | 3681-93-4 |
| Synonyms | 8-D-Glucosyl-4’,5,7-trihydroxyflavone; 5,7,4’-Trihydroxyflavone;8-C-β-D-glucopyranoside; 8-C-Glucosylapigenin; 8-C-β-D-Glucopyranosylapigenin; Apigenin 8-C-glucoside; Apigenin 8-C-β-D-glucoside; Apigenin 8-C-β-glucopyranoside; Apigenin-8-C-β-D-glucop |
| Molecular Formula | C21H20O10 |
| Purity | ≥95% |
| Target | Autophagy |
| Storage | -20°C |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
| InChI | InChI=1S/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17-,18+,19-,21+/m1/s1 |
| InChIKey | SGEWCQFRYRRZDC-VPRICQMDSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=O)C3=C(O2)C(=C(C=C3O)O)C4C(C(C(C(O4)CO)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
