For research use only. Not for therapeutic Use.
VLX600（Cat No.:R026987）is a small-molecule inhibitor that targets oxidative phosphorylation, specifically developed to combat hypoxic and nutrient-deprived tumor environments. By disrupting mitochondrial respiration, VLX600 induces metabolic stress in cancer cells, particularly targeting dormant cells in solid tumors resistant to standard therapies. This compound has shown efficacy in preclinical studies against several cancer types, exploiting the vulnerabilities of cancer cells under hypoxic conditions. VLX600’s unique mechanism positions it as a promising candidate for combination therapies, advancing the exploration of metabolic interventions in oncology and targeting therapy-resistant cancer cells.
| Catalog Number | R026987 |
| CAS Number | 327031-55-0 |
| Synonyms | 1-(2-Pyridinyl)ethanone 2-(6-Methyl-5H-1,2,4-triazino[5,6-b]indol-3-yl)hydrazone; |
| Molecular Formula | C17H15N7 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 6-methyl-N-[(E)-1-pyridin-2-ylethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| InChI | InChI=1S/C17H15N7/c1-10-6-5-7-12-14(10)19-16-15(12)22-24-17(20-16)23-21-11(2)13-8-3-4-9-18-13/h3-9H,1-2H3,(H2,19,20,23,24)/b21-11+ |
| InChIKey | UQOSBPRTQFFUOA-SRZZPIQSSA-N |
| SMILES | CC1=C2C(=CC=C1)C3=C(N2)N=C(N=N3)N/N=C(\C)/C4=CC=CC=N4 |
